This is an automated email from the ASF dual-hosted git repository.

viirya pushed a commit to branch master
in repository https://gitbox.apache.org/repos/asf/spark.git


The following commit(s) were added to refs/heads/master by this push:
     new 59d4fa29acc1 [SPARK-56642][SQL] Add pipelined JVM-Python UDF data 
transfer
59d4fa29acc1 is described below

commit 59d4fa29acc11361b374965e1f9bbc4cad691d31
Author: Liang-Chi Hsieh <[email protected]>
AuthorDate: Thu Jun 25 14:38:36 2026 -0700

    [SPARK-56642][SQL] Add pipelined JVM-Python UDF data transfer
    
    ### What changes were proposed in this pull request?
    
    Add an opt-in pipelined execution mode for Python UDFs 
(spark.python.udf.pipelined.enabled). When enabled, a dedicated writer thread 
serializes input and writes directly to the Python worker socket in blocking 
mode, while the task main thread reads output from the same socket 
concurrently. Socket full-duplex allows both directions to overlap, achieving 
pipeline parallelism.
    
    Key changes:
      - PipelinedWriterRunnable in PythonRunner.scala: serializes input + 
writes to socket in a pool thread
      - pipelined_process() in worker.py: background reader thread pre-fetches 
input batches; lazy iterators from grouped/aggregate serializers are eagerly 
materialized to avoid cross-thread socket conflicts
      - InMemoryRowQueue gains a lockFree parameter: when true (pipelined mode 
only), synchronized is skipped since blocking socket I/O already provides 
happens-before guarantees
      - Proper propagation of TaskContext and InputFileBlockHolder to the 
writer pool thread
      - Socket idle timeout handling via SO_TIMEOUT + SocketTimeoutException 
wrapper
    
      Benchmark: `python/pyspark/sql/tests/pandas/bench_pipelined_udf.py`
      Environment: local[*] (16 cores), 5 iterations, 2 warmup
    
      | Scenario                     | Sync (ms) | Pipelined (ms) | Speedup   |
      |------------------------------|-----------|----------------|-----------|
      | Light UDF (1M rows)          |       100 |             90 |   1.11x   |
      | CPU-bound UDF (1M rows)      |       143 |            146 |   0.98x   |
      | Heavy UDF (10ms sleep/batch) |      1180 |           1176 |   1.00x   |
      | Large data (5M rows)         |       338 |            300 | **1.13x** |
      | Multi-UDF (3 columns, 1M)    |       123 |            100 | **1.24x** |
    
    ASV Benchmark: `python/benchmarks/bench_pipelined_udf.py`
      **ScalarUDFTimeBench** (scalar UDF `x + 1`)
    
      | pipelined | 100K rows | 1M rows |
      |-----------|-----------|---------|
      | False | 122±0ms | 200±0ms |
      | True | 86.5±0ms | 164±0ms |
    
      **LargeDataUDFTimeBench** (5M rows, scalar UDF `x + 1`)
    
      | pipelined | time | peak memory |
      |-----------|------|-------------|
      | False | 526±0ms | 116M |
      | True | 496±0ms | 110M |
    
      **MultiUDFTimeBench** (3 UDF columns)
    
      | pipelined | 100K rows | 1M rows |
      |-----------|-----------|---------|
      | False | 157±0ms | 305±0ms |
      | True | 123±0ms | 269±0ms |
    
      Memory usage is the same for both modes (~110M).
    
    #### Relationship to SPARK-44705
    
    SPARK-44705 made PythonRunner single-threaded by removing the original 
WriterThread. That WriterThread shared a single blocking java.net.Socket with 
the main reader thread, where Thread.interrupt() does not unblock 
OutputStream.write. This led to two recurring bugs:
    
      - SPARK-33277 — race between writer-thread access to off-heap rows and 
the FileScan task-completion listener freeing those rows; segfault.
      - SPARK-38677 — three-way deadlock (task → writer → python → task) 
because interrupt() couldn't unblock the writer's blocking socket write.
    
    SPARK-44705 mitigated both by collapsing to one thread + SocketChannel 
selector and required a few monitor threads to keep the design tractable. This 
PR is not a revert — the existing single-threaded selector path remains the 
default and is unchanged. The new pipelined path is opt-in 
(spark.python.udf.pipelined.enabled=false by default) and is structured so the 
two original bugs do not return.
    
    | | Pre-44705 `WriterThread` | This PR's pipelined path |
    | --- | --- | --- |
    | Socket API | `java.net.Socket.OutputStream` — `Thread.interrupt()` does 
**not** unblock `write` | `java.nio.channels.SocketChannel` — 
`Thread.interrupt()` closes the channel and throws `ClosedByInterruptException` 
|
    | Cancel + cleanup | `interrupt() + join()`; could deadlock (SPARK-38677), 
needed a `WriterMonitorThread` to break it | `Future.cancel(true) + 
Future.get()`; `cancel(true)` reliably unblocks the writer, `get()` then 
provides the same SPARK-33277 ordering guarantee as `join()`, no monitor thread 
required |
    
    A regression test mirroring the SPARK-33277 reproducer 
(`test_offheap_reader_with_head_does_not_segfault`) is included.
    
    ### Why are the changes needed?
    
    The current single-threaded NIO selector model serializes input and reads 
output in the same thread alternately. For multi-column UDFs or compute-heavy 
UDFs, this leaves the JVM idle while waiting for Python output. Pipelined mode 
overlaps serialization with output reading, improving throughput by up to 22% 
for multi-UDF queries and 10% for large data workloads.
    
    ### Does this PR introduce _any_ user-facing change?
    
    No
    
    ### How was this patch tested?
    
      - New dedicated test suite test_pipelined_udf.py with 12 tests running 
with spark.python.udf.pipelined.enabled=true via SparkConf, covering scalar 
UDF, string UDF, multi-column UDF, chained UDF, null handling, UDAF, empty 
partitions, multiple partitions, large data, batched UDF, and exception 
propagation
      - All PySpark UDF test suites pass with pipelined=true as the 
compile-time default: test_pandas_udf_scalar, test_pandas_udf_grouped_agg, 
test_pandas_udf_window, test_udf, test_udtf
      - JVM test suites pass: PythonUDFSuite, BatchEvalPythonExecSuite, 
ArrowColumnarPythonUDFSuite
      - Benchmark (bench_pipelined_udf.py) across 5 scenarios confirms no 
regression vs sync mode and up to 22% speedup for multi-UDF workloads
    
    ### Was this patch authored or co-authored using generative AI tooling?
    
    Generated-by: Claude Code
    
    Closes #55552 from viirya/pipelined-python-udf.
    
    Authored-by: Liang-Chi Hsieh <[email protected]>
    Signed-off-by: Liang-Chi Hsieh <[email protected]>
---
 .../org/apache/spark/api/python/PythonRunner.scala | 257 ++++++++++++++++-
 .../org/apache/spark/internal/config/Python.scala  |  25 ++
 dev/sparktestsupport/modules.py                    |   1 +
 python/benchmarks/bench_pipelined_udf.py           | 220 +++++++++++++++
 python/pyspark/sql/pandas/serializers.py           |   7 +-
 .../sql/tests/pandas/bench_pipelined_udf.py        | 305 +++++++++++++++++++++
 .../pyspark/sql/tests/pandas/test_pipelined_udf.py | 285 +++++++++++++++++++
 python/pyspark/worker.py                           | 101 ++++++-
 .../python/ArrowAggregatePythonExec.scala          |   7 +-
 .../python/ArrowWindowPythonEvaluatorFactory.scala |   6 +-
 .../ColumnarArrowEvalPythonEvaluatorFactory.scala  |   7 +-
 .../python/EvalPythonEvaluatorFactory.scala        |   8 +-
 .../sql/execution/python/EvalPythonUDTFExec.scala  |   6 +-
 .../spark/sql/execution/python/RowQueue.scala      |  66 ++++-
 14 files changed, 1274 insertions(+), 27 deletions(-)

diff --git a/core/src/main/scala/org/apache/spark/api/python/PythonRunner.scala 
b/core/src/main/scala/org/apache/spark/api/python/PythonRunner.scala
index 896ab6e3b19d..ee15bd5e46ef 100644
--- a/core/src/main/scala/org/apache/spark/api/python/PythonRunner.scala
+++ b/core/src/main/scala/org/apache/spark/api/python/PythonRunner.scala
@@ -23,7 +23,7 @@ import java.nio.ByteBuffer
 import java.nio.channels.{AsynchronousCloseException, Channels, SelectionKey, 
ServerSocketChannel, SocketChannel}
 import java.nio.file.{Files => JavaFiles, Path}
 import java.util.UUID
-import java.util.concurrent.{ConcurrentHashMap, TimeUnit}
+import java.util.concurrent.{CancellationException, ConcurrentHashMap, 
ExecutionException, TimeUnit}
 import java.util.concurrent.atomic.AtomicBoolean
 
 import scala.jdk.CollectionConverters._
@@ -121,6 +121,21 @@ private[spark] object PythonEvalType {
 
 private[spark] object BasePythonRunner extends Logging {
 
+  /**
+   * Shared thread pool for pipelined writer tasks. Using a cached thread pool 
ensures that
+   * writer threads are reused across tasks, which keeps JIT-compiled code, 
branch prediction
+   * history, and CPU caches warm.
+   * Bounded by executor cores since each task uses at most one writer thread.
+   */
+  private[python] lazy val pipelinedWriterThreadPool = {
+    // Each concurrent task uses at most one writer thread. Bound the pool by 
available
+    // processors, which is the natural upper limit for concurrent tasks on 
this executor.
+    // Using availableProcessors() instead of EXECUTOR_CORES because the 
latter defaults
+    // to 1 in local[*] mode even though multiple tasks run concurrently.
+    val maxThreads = Runtime.getRuntime.availableProcessors()
+    ThreadUtils.newDaemonCachedThreadPool("python-udf-pipelined-writer", 
maxThreads)
+  }
+
   private[spark] lazy val faultHandlerLogDir = Utils.createTempDir(namePrefix 
= "faulthandler")
 
   private[spark] def faultHandlerLogPath(pid: Int): Path = {
@@ -211,6 +226,8 @@ private[spark] abstract class BasePythonRunner[IN, OUT](
     conf.get(PYTHON_WORKER_TRACEBACK_DUMP_INTERVAL_SECONDS)
   protected val killWorkerOnFlushFailure: Boolean =
      conf.get(PYTHON_DAEMON_KILL_WORKER_ON_FLUSH_FAILURE)
+  protected val pipelinedEnabled: Boolean = 
conf.get(PYTHON_UDF_PIPELINED_EXECUTION)
+  protected val pipelinedQueueDepth: Int = 
conf.get(PYTHON_UDF_PIPELINED_QUEUE_DEPTH)
   protected val hideTraceback: Boolean = false
   protected val simplifiedTraceback: Boolean = false
   protected val tracebackWithLocals: Boolean = false
@@ -329,6 +346,12 @@ private[spark] abstract class BasePythonRunner[IN, OUT](
 
     envVars.put("SPARK_JOB_ARTIFACT_UUID", 
jobArtifactUUID.getOrElse("default"))
     envVars.put("SPARK_PYTHON_RUNTIME", "PYTHON_WORKER")
+    // Pipelined mode is only for UDF eval types, not NON_UDF 
(mapPartitions/RDD path).
+    val usePipelined = pipelinedEnabled && evalType != PythonEvalType.NON_UDF
+    if (usePipelined) {
+      envVars.put("SPARK_PIPELINED_UDF", "1")
+      envVars.put("SPARK_PIPELINED_UDF_QUEUE_DEPTH", 
pipelinedQueueDepth.toString)
+    }
 
     val (worker: PythonWorker, handle: Option[ProcessHandle]) = 
env.createPythonWorker(
       pythonExec, workerModule, daemonModule, envVars.asScala.toMap, useDaemon)
@@ -363,15 +386,128 @@ private[spark] abstract class BasePythonRunner[IN, OUT](
     }
 
     // Return an iterator that read lines from the process's stdout
-    val dataIn = new DataInputStream(new BufferedInputStream(
-      new ReaderInputStream(worker, writer, handle,
-        faultHandlerEnabled, idleTimeoutSeconds, killOnIdleTimeout, context),
-      bufferSize))
+    val dataIn = if (usePipelined) {
+      createPipelinedDataIn(worker, writer, handle, context)
+    } else {
+      new DataInputStream(new BufferedInputStream(
+        new ReaderInputStream(worker, writer, handle,
+          faultHandlerEnabled, idleTimeoutSeconds, killOnIdleTimeout, context),
+        bufferSize))
+    }
     val stdoutIterator = newReaderIterator(
       dataIn, writer, startTime, env, worker, handle.map(_.pid.toInt), 
releasedOrClosed, context)
     new InterruptibleIterator(context, stdoutIterator)
   }
 
+  /**
+   * Sets up pipelined mode: switches the socket to blocking mode, starts the 
writer
+   * thread, configures idle timeout, and returns a DataInputStream for 
reading output.
+   */
+  private def createPipelinedDataIn(
+      worker: PythonWorker,
+      writer: Writer,
+      handle: Option[ProcessHandle],
+      context: TaskContext): DataInputStream = {
+    // Switch the channel to blocking mode for true full-duplex I/O.
+    // Must close the selector first because configureBlocking() fails
+    // if the channel is registered with a selector 
(IllegalBlockingModeException).
+    if (worker.selectionKey != null) {
+      worker.selectionKey.cancel()
+    }
+    if (worker.selector != null) {
+      worker.selector.close()
+    }
+    worker.channel.configureBlocking(true)
+    worker.refresh() // re-initializes (no selector in blocking mode)
+
+    val writerRunnable = new PipelinedWriterRunnable(worker, writer, 
bufferSize, context)
+    val writerFuture = 
BasePythonRunner.pipelinedWriterThreadPool.submit(writerRunnable)
+
+    // Wait for the writer to actually exit before letting subsequent task 
completion listeners
+    // run. Subsequent listeners (registered earlier, executed later under 
LIFO) free off-heap
+    // memory backing the input rows; if the writer is still serializing such 
a row when free
+    // happens, we get a use-after-free segfault (SPARK-33277). cancel(true) 
is enough to unblock
+    // a writer stuck on channel.write (JDK closes the SocketChannel and throws
+    // ClosedByInterruptException on interrupt), so this get() returns 
promptly in normal cases;
+    // the worst case is a bounded wait for the writer to finish serializing 
the current row or
+    // batch and observe the interrupt flag at the top of its loop.
+    context.addTaskCompletionListener[Unit] { _ =>
+      writerFuture.cancel(true)
+      try {
+        writerFuture.get()
+      } catch {
+        case _: CancellationException | _: ExecutionException | _: 
InterruptedException =>
+          // Expected: cancel(true) raced ahead, or writer exited via 
_exception path.
+      }
+    }
+
+    // Set socket read timeout for idle timeout detection in pipelined mode.
+    // Always set explicitly (including 0 = no timeout) because reused workers 
may
+    // retain a stale SO_TIMEOUT from a previous task that had a different 
setting.
+    worker.channel.socket().setSoTimeout(
+      if (idleTimeoutSeconds > 0) idleTimeoutSeconds.toInt * 1000 else 0)
+
+    // Wrap the socket InputStream to handle idle timeout, matching sync mode 
behavior:
+    // - Log warning on each timeout
+    // - If killOnIdleTimeout=true: kill worker, then throw 
PythonWorkerException
+    // - If killOnIdleTimeout=false: log only, retry read (continue waiting)
+    val socketInput = new InputStream {
+      private val inner = worker.channel.socket().getInputStream
+      private var pythonWorkerKilled = false
+      override def read(): Int = doRead(() => inner.read())
+      override def read(b: Array[Byte], off: Int, len: Int): Int =
+        doRead(() => inner.read(b, off, len))
+      private def doRead(op: () => Int): Int = {
+        var result = 0
+        var retry = true
+        while (retry) {
+          try {
+            result = op()
+            retry = false
+          } catch {
+            case _: java.net.SocketTimeoutException =>
+              if (pythonWorkerKilled) {
+                logWarning(
+                  log"Waiting for Python worker process to terminate after 
idle timeout: " +
+                  pythonWorkerStatusMessageWithContext(
+                    handle, worker, hasInputs = true))
+              } else {
+                logWarning(
+                  log"Idle timeout reached for Python worker (timeout: " +
+                  log"${MDC(PYTHON_WORKER_IDLE_TIMEOUT, idleTimeoutSeconds)} 
seconds). " +
+                  log"No data received from the worker process - " +
+                  pythonWorkerStatusMessageWithContext(
+                    handle, worker, hasInputs = true) +
+                  log" - ${MDC(TASK_NAME, taskIdentifier(context))}")
+                if (killOnIdleTimeout) {
+                  handle.foreach { h =>
+                    if (h.isAlive) {
+                      logWarning(
+                        log"Terminating Python worker process due to idle 
timeout " +
+                        log"(timeout: " +
+                        log"${MDC(PYTHON_WORKER_IDLE_TIMEOUT, 
idleTimeoutSeconds)} " +
+                        log"seconds) - ${MDC(TASK_NAME, 
taskIdentifier(context))}")
+                      pythonWorkerKilled = h.destroy()
+                    }
+                  }
+                }
+              }
+          }
+        }
+        if (result == -1 && pythonWorkerKilled) {
+          val base = "Python worker process terminated due to idle timeout " +
+            s"(timeout: $idleTimeoutSeconds seconds)"
+          val msg = tryReadFaultHandlerLog(faultHandlerEnabled, 
handle.map(_.pid.toInt))
+            .map(error => s"$base: $error")
+            .getOrElse(base)
+          throw new PythonWorkerException(msg)
+        }
+        result
+      }
+    }
+    new DataInputStream(new BufferedInputStream(socketInput, bufferSize))
+  }
+
   protected def newWriter(
       env: SparkEnv,
       worker: PythonWorker,
@@ -408,6 +544,11 @@ private[spark] abstract class BasePythonRunner[IN, OUT](
     /** Contains the throwable thrown while writing the parent iterator to the 
Python process. */
     def exception: Option[Throwable] = Option(_exception)
 
+    /** Records a throwable observed by an external collaborator (e.g. the 
pipelined writer). */
+    private[python] def setException(t: Throwable): Unit = {
+      _exception = t
+    }
+
     /**
      * Writes a command section to the stream connected to the Python worker.
      */
@@ -1000,6 +1141,112 @@ private[spark] abstract class BasePythonRunner[IN, OUT](
     }
   }
 
+  /**
+   * A dedicated thread that serializes input data and writes it directly to 
the Python worker
+   * socket in blocking mode. The task main thread simultaneously reads output 
from the same
+   * socket. TCP sockets are full-duplex, so concurrent read() and write() 
from different
+   * threads is safe -- they operate on independent OS-level buffers.
+   *
+   * This design achieves true pipeline parallelism without any inter-thread 
queues or locks:
+   *   Writer Thread:  serialize batch N  ->  channel.write(batch N)    
[blocking]
+   *   Reader Thread:  channel.read(output N-1)                        
[blocking]
+   *   Python:         read batch N-1  ->  compute  ->  write output  ->  read 
batch N
+   *
+   * Deadlock safety: Python's UDF loop is "read input -> compute -> write 
output -> repeat".
+   * As long as the reader thread is consuming Python's output (freeing 
Python's send buffer),
+   * Python will eventually consume input from the socket (freeing the JVM's 
send buffer for
+   * the writer thread). The reader thread is always actively reading because 
the task's
+   * downstream operators pull output on demand.
+   *
+   * Unlike the old WriterThread (removed in SPARK-44705), this design uses a 
blocking socket
+   * in full-duplex mode rather than two threads competing on the same 
blocking socket with
+   * shared mutable state. The old design's deadlocks were caused by complex 
interactions
+   * with vectorized readers and monitor threads, not by the fundamental 
read/write split.
+   */
+  class PipelinedWriterRunnable(
+      worker: PythonWorker,
+      writer: Writer,
+      bufferSize: Int,
+      context: TaskContext)
+    extends Runnable {
+
+    // Capture InputFileBlockHolder from the task thread so we can propagate it
+    // to the writer pool thread. This is needed because upstream scan 
operators
+    // set InputFileBlockHolder via InheritableThreadLocal, but pool threads
+    // don't inherit from the task thread.
+    private val parentInputFileBlockHolder = 
InputFileBlockHolder.getThreadLocalValue()
+
+    override def run(): Unit = {
+      // Propagate TaskContext and InputFileBlockHolder to the pool thread so 
that
+      // upstream operators work correctly.
+      TaskContext.setTaskContext(context)
+      InputFileBlockHolder.setThreadLocalValue(parentInputFileBlockHolder)
+      val bufferStream = new DirectByteBufferOutputStream(bufferSize)
+      val dataOut = new DataOutputStream(bufferStream)
+      try {
+        // Write command/metadata (partition index, task context, broadcasts, 
UDF definition).
+        writer.open(dataOut)
+        flushToSocket(bufferStream)
+
+        // Write input data in a loop, batching into buffers of ~bufferSize.
+        var hasInput = true
+        while (hasInput && !Thread.currentThread().isInterrupted) {
+          hasInput = writer.writeNextInputToStream(dataOut)
+          if (bufferStream.size() >= bufferSize || !hasInput) {
+            if (!hasInput) {
+              writer.close(dataOut)
+            }
+            flushToSocket(bufferStream)
+          }
+        }
+      } catch {
+        case _: InterruptedException =>
+          // Task cancelled via Future.cancel(true)
+          Thread.currentThread().interrupt()
+        case _: java.nio.channels.ClosedByInterruptException =>
+          // Task cancelled while blocked in channel.write(). The channel is
+          // automatically closed by the JVM, which will cause Python to 
receive
+          // EOF and the reader thread to get IOException.
+          Thread.currentThread().interrupt()
+        case NonFatal(t) =>
+          // InterruptedException and ClosedByInterruptException are matched 
above; what
+          // remains here is genuine non-fatal failure that needs to be 
propagated to the
+          // reader through writer.exception + a socket EOF.
+          writer.setException(t)
+          // Shut down the socket output so Python receives EOF and terminates.
+          // This unblocks the reader thread which is waiting on socket input:
+          // Python will exit, closing its end of the socket, causing the 
reader's
+          // read() to return -1. The ReaderIterator will then check 
writer.exception
+          // and propagate the failure.
+          if (worker.channel.isConnected) {
+            Utils.tryLog(worker.channel.shutdownOutput())
+          }
+      } finally {
+        TaskContext.unset()
+        InputFileBlockHolder.unset()
+        try {
+          bufferStream.close()
+        } catch {
+          case _: Exception => // ignore
+        }
+      }
+    }
+
+    /**
+     * Writes all buffered data to the socket and resets the buffer for reuse.
+     * Uses the DirectByteBufferOutputStream's direct buffer view for zero-copy
+     * socket writes. The write() call is blocking -- it will wait until the OS
+     * socket send buffer has room, which provides natural backpressure.
+     */
+    private def flushToSocket(bufferStream: DirectByteBufferOutputStream): 
Unit = {
+      val buf = bufferStream.toByteBuffer
+      while (buf.hasRemaining) {
+        worker.channel.write(buf) // blocking write
+      }
+      bufferStream.reset()
+    }
+  }
+
 }
 
 private[spark] object PythonRunner {
diff --git a/core/src/main/scala/org/apache/spark/internal/config/Python.scala 
b/core/src/main/scala/org/apache/spark/internal/config/Python.scala
index dc16d1ff255d..1f5829226d88 100644
--- a/core/src/main/scala/org/apache/spark/internal/config/Python.scala
+++ b/core/src/main/scala/org/apache/spark/internal/config/Python.scala
@@ -150,4 +150,29 @@ private[spark] object Python {
       .version("4.1.0")
       .booleanConf
       .createWithDefault(true)
+
+  val PYTHON_UDF_PIPELINED_EXECUTION =
+    ConfigBuilder("spark.python.udf.pipelined.enabled")
+      .doc("When true, enables pipelined (asynchronous) data transfer between 
JVM and Python " +
+        "UDF workers. In pipelined mode, input serialization runs in a 
separate writer thread " +
+        "while the main task thread reads output from the Python worker, 
allowing the two " +
+        "directions to overlap. This can improve throughput for some workloads 
" +
+        "(e.g., multi-column UDFs or compute-heavy UDFs like ML inference); 
for light, " +
+        "single-column UDFs the overhead of the extra thread may offset the 
gain.")
+      .version("4.3.0")
+      .withBindingPolicy(ConfigBindingPolicy.NOT_APPLICABLE)
+      .booleanConf
+      .createWithDefault(false)
+
+  val PYTHON_UDF_PIPELINED_QUEUE_DEPTH =
+    ConfigBuilder("spark.python.udf.pipelined.queueDepth")
+      .doc("The maximum number of input batches the Python worker's background 
reader thread " +
+        "can pre-fetch ahead of UDF computation. A higher value allows more 
overlap between " +
+        "input reading and UDF processing, at the cost of increased memory 
usage. " +
+        "Only effective when spark.python.udf.pipelined.enabled is true.")
+      .version("4.3.0")
+      .withBindingPolicy(ConfigBindingPolicy.NOT_APPLICABLE)
+      .intConf
+      .checkValue(_ > 0, "Queue depth must be positive.")
+      .createWithDefault(2)
 }
diff --git a/dev/sparktestsupport/modules.py b/dev/sparktestsupport/modules.py
index c474b87c8b36..860158b941f6 100644
--- a/dev/sparktestsupport/modules.py
+++ b/dev/sparktestsupport/modules.py
@@ -605,6 +605,7 @@ pyspark_sql = Module(
         "pyspark.sql.tests.pandas.test_pandas_udf",
         "pyspark.sql.tests.pandas.test_pandas_udf_grouped_agg",
         "pyspark.sql.tests.pandas.test_pandas_udf_scalar",
+        "pyspark.sql.tests.pandas.test_pipelined_udf",
         "pyspark.sql.tests.pandas.test_pandas_udf_typehints",
         
"pyspark.sql.tests.pandas.test_pandas_udf_typehints_with_future_annotations",
         "pyspark.sql.tests.pandas.test_pandas_udf_window",
diff --git a/python/benchmarks/bench_pipelined_udf.py 
b/python/benchmarks/bench_pipelined_udf.py
new file mode 100644
index 000000000000..31eb9d0b16e3
--- /dev/null
+++ b/python/benchmarks/bench_pipelined_udf.py
@@ -0,0 +1,220 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+"""
+End-to-end benchmarks for pipelined vs synchronous Python UDF execution.
+
+Unlike the microbenchmarks in bench_eval_type.py (which test the Python worker
+in isolation), these benchmarks run full Spark queries through a real
+SparkSession to measure the JVM-Python socket I/O pipeline overlap.
+"""
+
+import pandas as pd
+
+from pyspark import SparkConf
+from pyspark.sql import SparkSession
+from pyspark.sql.functions import col, pandas_udf
+from pyspark.sql.types import LongType, StringType
+
+
+class _PipelinedUDFBenchBase:
+    """Base class for pipelined UDF benchmarks.
+
+    Each benchmark parameterizes over pipelined=true/false to compare
+    the two execution modes. SparkSession is created in setup() and
+    stopped in teardown() because spark.python.udf.pipelined.enabled
+    is a SparkConf-level config.
+    """
+
+    # Subclasses must define timeout (seconds per benchmark iteration).
+    timeout = 120
+
+    def _spark_conf(self, pipelined):
+        return (
+            SparkConf()
+            .setMaster("local[1]")
+            .setAppName("PipelinedUDFBench")
+            .set("spark.sql.execution.arrow.pyspark.enabled", "true")
+            .set("spark.python.worker.reuse", "true")
+            .set("spark.ui.enabled", "false")
+            .set("spark.sql.shuffle.partitions", "1")
+            .set("spark.python.udf.pipelined.enabled", str(pipelined).lower())
+        )
+
+    def _setup_spark(self, pipelined):
+        conf = self._spark_conf(pipelined)
+        self.spark = SparkSession.builder.config(conf=conf).getOrCreate()
+
+        @pandas_udf(LongType())
+        def _add_one(x: pd.Series) -> pd.Series:
+            return x + 1
+
+        self._add_one = _add_one
+
+        # Warmup: start Python worker, JIT
+        
self.spark.range(100).select(_add_one(col("id"))).write.format("noop").mode(
+            "overwrite"
+        ).save()
+
+    def _teardown_spark(self):
+        if hasattr(self, "spark"):
+            self.spark.stop()
+            # Clear the active session so the next setup() creates a fresh one
+            SparkSession.builder._options = {}
+
+
+class ScalarUDFTimeBench(_PipelinedUDFBenchBase):
+    """Benchmark scalar Arrow UDF with light computation (x + 1)."""
+
+    params = [[False, True], [100000, 1000000]]
+    param_names = ["pipelined", "n_rows"]
+
+    def setup(self, pipelined, n_rows):
+        self._setup_spark(pipelined)
+
+    def teardown(self, pipelined, n_rows):
+        self._teardown_spark()
+
+    def time_scalar_udf(self, pipelined, n_rows):
+        
self.spark.range(n_rows).select(self._add_one(col("id")).alias("result")).write.format(
+            "noop"
+        ).mode("overwrite").save()
+
+    def peakmem_scalar_udf(self, pipelined, n_rows):
+        
self.spark.range(n_rows).select(self._add_one(col("id")).alias("result")).write.format(
+            "noop"
+        ).mode("overwrite").save()
+
+
+class MultiUDFTimeBench(_PipelinedUDFBenchBase):
+    """Benchmark multiple UDF columns in a single query."""
+
+    params = [[False, True], [100000, 1000000]]
+    param_names = ["pipelined", "n_rows"]
+
+    def setup(self, pipelined, n_rows):
+        self._setup_spark(pipelined)
+
+        @pandas_udf(LongType())
+        def _mul_two(x: pd.Series) -> pd.Series:
+            return x * 2
+
+        @pandas_udf(LongType())
+        def _sub_one(x: pd.Series) -> pd.Series:
+            return x - 1
+
+        self._mul_two = _mul_two
+        self._sub_one = _sub_one
+
+    def teardown(self, pipelined, n_rows):
+        self._teardown_spark()
+
+    def time_multi_udf(self, pipelined, n_rows):
+        self.spark.range(n_rows).select(
+            col("id"),
+            self._add_one(col("id")).alias("a"),
+            self._mul_two(col("id")).alias("b"),
+            self._sub_one(col("id")).alias("c"),
+        ).write.format("noop").mode("overwrite").save()
+
+    def peakmem_multi_udf(self, pipelined, n_rows):
+        self.spark.range(n_rows).select(
+            col("id"),
+            self._add_one(col("id")).alias("a"),
+            self._mul_two(col("id")).alias("b"),
+            self._sub_one(col("id")).alias("c"),
+        ).write.format("noop").mode("overwrite").save()
+
+
+class LargeDataUDFTimeBench(_PipelinedUDFBenchBase):
+    """Benchmark scalar UDF with large data to exercise throughput."""
+
+    params = [[False, True]]
+    param_names = ["pipelined"]
+
+    def setup(self, pipelined):
+        self._setup_spark(pipelined)
+
+    def teardown(self, pipelined):
+        self._teardown_spark()
+
+    def time_large_data(self, pipelined):
+        
self.spark.range(5000000).select(self._add_one(col("id")).alias("result")).write.format(
+            "noop"
+        ).mode("overwrite").save()
+
+    def peakmem_large_data(self, pipelined):
+        
self.spark.range(5000000).select(self._add_one(col("id")).alias("result")).write.format(
+            "noop"
+        ).mode("overwrite").save()
+
+
+class WideRowUDFTimeBench(_PipelinedUDFBenchBase):
+    """Benchmark scalar UDF with larger per-batch in-memory size.
+
+    Each row carries a wide string payload and the Arrow batch size is bumped 
so
+    one batch is ~10-50 MB rather than ~80 KB. This exercises the regime that
+    Yicong-Huang asked about in the SPARK-56642 review: how does pipelined mode
+    behave when each batch is large enough that the queue's memory overhead is
+    no longer negligible?
+    """
+
+    # (pipelined, n_rows, payload_chars, records_per_batch)
+    # 50_000 rows * 1024 chars = ~50 MB raw per dataset; with records_per_batch
+    # = 10_000 that's ~10 MB per Arrow batch.
+    params = [
+        [False, True],
+        [(50_000, 1024, 10_000), (50_000, 4096, 5_000)],
+    ]
+    param_names = ["pipelined", "shape"]
+
+    def setup(self, pipelined, shape):
+        n_rows, payload_chars, records_per_batch = shape
+        self._setup_spark(pipelined)
+        self.spark.conf.set("spark.sql.execution.arrow.maxRecordsPerBatch", 
str(records_per_batch))
+        self._n_rows = n_rows
+        self._payload_chars = payload_chars
+
+        @pandas_udf(StringType())
+        def _wide_passthrough(s: pd.Series) -> pd.Series:
+            # Non-trivial work proportional to row width so the UDF actually
+            # holds a batch for a measurable amount of time.
+            return s.str.upper()
+
+        self._wide_udf = _wide_passthrough
+
+    def teardown(self, pipelined, shape):
+        self._teardown_spark()
+
+    def _make_df(self):
+        chars = self._payload_chars
+
+        @pandas_udf(StringType())
+        def _make_payload(x: pd.Series) -> pd.Series:
+            return pd.Series(["x" * chars] * len(x))
+
+        return 
self.spark.range(self._n_rows).select(_make_payload(col("id")).alias("payload"))
+
+    def time_wide_row_udf(self, pipelined, shape):
+        
self._make_df().select(self._wide_udf(col("payload")).alias("result")).write.format(
+            "noop"
+        ).mode("overwrite").save()
+
+    def peakmem_wide_row_udf(self, pipelined, shape):
+        
self._make_df().select(self._wide_udf(col("payload")).alias("result")).write.format(
+            "noop"
+        ).mode("overwrite").save()
diff --git a/python/pyspark/sql/pandas/serializers.py 
b/python/pyspark/sql/pandas/serializers.py
index d6bf3b7d7416..20e1f80a99b4 100644
--- a/python/pyspark/sql/pandas/serializers.py
+++ b/python/pyspark/sql/pandas/serializers.py
@@ -127,9 +127,10 @@ class ArrowStreamSerializer(Serializer):
         output batch. Default False.
     """
 
-    def __init__(self, write_start_stream: bool = False) -> None:
+    def __init__(self, write_start_stream: bool = False, flush_per_batch: bool 
= False) -> None:
         super().__init__()
         self._write_start_stream: bool = write_start_stream
+        self._flush_per_batch: bool = flush_per_batch
 
     def dump_stream(self, iterator: Iterable["pa.RecordBatch"], stream: 
IO[bytes]) -> None:
         """Optionally prepend START_ARROW_STREAM, then write batches."""
@@ -144,6 +145,10 @@ class ArrowStreamSerializer(Serializer):
                 if writer is None:
                     writer = pa.RecordBatchStreamWriter(stream, batch.schema)
                 writer.write_batch(batch)
+                # In pipelined mode, flush after each batch so the JVM can 
read output
+                # while still sending input, rather than buffering all output.
+                if self._flush_per_batch:
+                    stream.flush()
         finally:
             if writer is not None:
                 writer.close()
diff --git a/python/pyspark/sql/tests/pandas/bench_pipelined_udf.py 
b/python/pyspark/sql/tests/pandas/bench_pipelined_udf.py
new file mode 100644
index 000000000000..5deed766cbce
--- /dev/null
+++ b/python/pyspark/sql/tests/pandas/bench_pipelined_udf.py
@@ -0,0 +1,305 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+"""
+Benchmark: Pipelined vs synchronous JVM-Python UDF data transfer.
+
+Compares end-to-end execution time of Python UDFs with
+spark.python.udf.pipelined.enabled = true vs false.
+
+Because spark.python.udf.pipelined.enabled is a SparkConf-level config (read at
+SparkContext startup), each benchmark scenario runs in a separate subprocess 
with
+its own SparkSession to ensure the config takes effect.
+
+Note: In local[1] mode (single core), pipelined mode may show overhead because
+the writer thread and selector thread compete for the same CPU. The benefit of
+pipeline parallelism is expected on multi-core executors where serialization 
can
+overlap with output reading.
+
+Usage:
+    cd $SPARK_HOME
+    # Build Spark first (needed for PySpark to find JVM jars):
+    #   build/sbt -Phive package
+    #   cd python && zip -r lib/pyspark.zip pyspark && cd ..
+    python python/pyspark/sql/tests/pandas/bench_pipelined_udf.py \
+        [--rows N] [--iterations N] [--partitions N] [--sleep-ms N]
+"""
+
+import argparse
+import json
+import os
+import subprocess
+import sys
+
+
+SPARK_HOME = os.path.join(os.path.dirname(os.path.abspath(__file__)), 
"../../../../..")
+PIPELINED_CONF = "spark.python.udf.pipelined.enabled"
+QUEUE_DEPTH_CONF = "spark.python.udf.pipelined.queueDepth"
+
+
+# ---- Subprocess worker script template ----
+# Each benchmark scenario is run in a fresh Python process to get a fresh 
SparkContext.
+WORKER_TEMPLATE = """
+import os, sys, time, json
+sys.path.insert(0, "{spark_home}")
+
+import pandas as pd
+from pyspark.sql import SparkSession
+from pyspark.sql.functions import pandas_udf, col
+from pyspark.sql.types import LongType
+
+spark = (
+    SparkSession.builder.master("{master}")
+    .appName("PipelinedUDFBench")
+    .config("spark.sql.execution.arrow.pyspark.enabled", "true")
+    .config("spark.python.worker.reuse", "true")
+    .config("spark.ui.enabled", "false")
+    .config("spark.sql.shuffle.partitions", "1")
+    .config("{pipelined_conf}", "{pipelined}")
+    .config("{queue_depth_conf}", "{queue_depth}")
+    .getOrCreate()
+)
+
+{udf_code}
+
+df = {make_df_code}
+
+# Warmup
+for _ in range({warmup}):
+    df.write.format("noop").mode("overwrite").save()
+
+# Timed runs
+times = []
+for _ in range({iterations}):
+    start = time.perf_counter()
+    df.write.format("noop").mode("overwrite").save()
+    elapsed = time.perf_counter() - start
+    times.append(elapsed)
+
+# Output results as JSON to stdout
+print("BENCH_RESULT:" + json.dumps(times))
+spark.stop()
+"""
+
+
+def run_subprocess(pipelined, udf_code, make_df_code, args):
+    """Run a benchmark in a fresh subprocess, return list of timing results."""
+    script = WORKER_TEMPLATE.format(
+        spark_home=os.path.abspath(SPARK_HOME),
+        master=args.master,
+        pipelined_conf=PIPELINED_CONF,
+        pipelined="true" if pipelined else "false",
+        queue_depth_conf=QUEUE_DEPTH_CONF,
+        queue_depth=args.queue_depth,
+        udf_code=udf_code,
+        make_df_code=make_df_code,
+        warmup=args.warmup,
+        iterations=args.iterations,
+    )
+    env = os.environ.copy()
+    env["SPARK_HOME"] = os.path.abspath(SPARK_HOME)
+    py4j_zip = os.path.join(os.path.abspath(SPARK_HOME), 
"python/lib/py4j-0.10.9.9-src.zip")
+    pyspark_path = os.path.join(os.path.abspath(SPARK_HOME), "python")
+    env["PYTHONPATH"] = f"{pyspark_path}:{py4j_zip}:" + env.get("PYTHONPATH", 
"")
+
+    result = subprocess.run(
+        [sys.executable, "-c", script], capture_output=True, text=True, 
env=env, timeout=600
+    )
+
+    for line in result.stdout.splitlines():
+        if line.startswith("BENCH_RESULT:"):
+            return json.loads(line[len("BENCH_RESULT:") :])
+
+    print("  ERROR: no BENCH_RESULT in output")
+    print("  STDERR (last 500 chars):", result.stderr[-500:] if result.stderr 
else "<empty>")
+    return None
+
+
+def print_stats(label, times):
+    if not times:
+        print(f"    {label:40s}  FAILED")
+        return 0.0
+    avg = sum(times) / len(times)
+    mn = min(times)
+    mx = max(times)
+    print(
+        f"    {label:40s}  "
+        f"avg = {avg * 1000:8.1f} ms   "
+        f"min = {mn * 1000:8.1f} ms   "
+        f"max = {mx * 1000:8.1f} ms   "
+        f"({len(times)} iters)"
+    )
+    return avg
+
+
+def run_benchmark(label, udf_code, make_df_code, args):
+    """Run sync and pipelined in separate subprocesses, print comparison."""
+    print(f"  [{label}]")
+
+    sync_times = run_subprocess(False, udf_code, make_df_code, args)
+    sync_avg = print_stats("sync  (pipelined=false)", sync_times)
+
+    pipe_times = run_subprocess(True, udf_code, make_df_code, args)
+    pipe_avg = print_stats("pipelined (pipelined=true)", pipe_times)
+
+    if pipe_avg > 0 and sync_avg > 0:
+        speedup = sync_avg / pipe_avg
+        diff_ms = (sync_avg - pipe_avg) * 1000
+        marker = "faster" if speedup > 1.0 else "slower"
+        print(f"    --> pipelined is {speedup:.2f}x {marker} ({diff_ms:+.1f} 
ms)")
+    print()
+    return sync_avg, pipe_avg
+
+
+def main():
+    parser = argparse.ArgumentParser(
+        description="Benchmark pipelined vs synchronous Python UDF data 
transfer"
+    )
+    parser.add_argument(
+        "--rows",
+        type=int,
+        default=1_000_000,
+        help="Rows for standard benchmarks (default: 1000000)",
+    )
+    parser.add_argument(
+        "--large-rows",
+        type=int,
+        default=5_000_000,
+        help="Rows for large data benchmark (default: 5000000)",
+    )
+    parser.add_argument(
+        "--iterations", type=int, default=5, help="Timed iterations per 
scenario (default: 5)"
+    )
+    parser.add_argument("--warmup", type=int, default=2, help="Warmup 
iterations (default: 2)")
+    parser.add_argument(
+        "--partitions", type=int, default=1, help="Number of partitions 
(default: 1)"
+    )
+    parser.add_argument(
+        "--sleep-ms",
+        type=float,
+        default=10.0,
+        help="Sleep time in ms per batch for heavy UDF (default: 10.0)",
+    )
+    parser.add_argument(
+        "--queue-depth", type=int, default=2, help="Pipelined queue depth 
(default: 2)"
+    )
+    parser.add_argument(
+        "--master", type=str, default="local[1]", help="Spark master URL 
(default: local[1])"
+    )
+    args = parser.parse_args()
+
+    nparts = args.partitions
+
+    print("=" * 78)
+    print("  Pipelined vs Synchronous Python UDF Data Transfer Benchmark")
+    print("=" * 78)
+    print(
+        f"  master={args.master}  rows={args.rows}  
large_rows={args.large_rows}  "
+        f"partitions={nparts}"
+    )
+    print(
+        f"  iterations={args.iterations}  warmup={args.warmup}  "
+        f"sleep_ms={args.sleep_ms}  queue_depth={args.queue_depth}"
+    )
+    print()
+
+    # --- Benchmark 1: Light UDF ---
+    run_benchmark(
+        "Light UDF (x + 1)",
+        udf_code="""
+@pandas_udf(LongType())
+def bench_udf(x: pd.Series) -> pd.Series:
+    return x + 1
+""",
+        make_df_code=f"spark.range({args.rows}, numPartitions={nparts})"
+        f'.select(col("id"), bench_udf(col("id")).alias("result"))',
+        args=args,
+    )
+
+    # --- Benchmark 2: CPU-bound UDF ---
+    run_benchmark(
+        "CPU-bound UDF (iterative computation)",
+        udf_code="""
+@pandas_udf(LongType())
+def bench_udf(x: pd.Series) -> pd.Series:
+    result = x + 1
+    for _ in range(20):
+        result = result + (x % 7) - 3
+    return result
+""",
+        make_df_code=f"spark.range({args.rows}, numPartitions={nparts})"
+        f'.select(col("id"), bench_udf(col("id")).alias("result"))',
+        args=args,
+    )
+
+    # --- Benchmark 3: Heavy UDF (sleep) ---
+    run_benchmark(
+        f"Heavy UDF ({args.sleep_ms}ms sleep/batch)",
+        udf_code=f"""
+import time as _time
+@pandas_udf(LongType())
+def bench_udf(x: pd.Series) -> pd.Series:
+    _time.sleep({args.sleep_ms / 1000.0})
+    return x + 1
+""",
+        make_df_code=f"spark.range({args.rows}, numPartitions={nparts})"
+        f'.select(col("id"), bench_udf(col("id")).alias("result"))',
+        args=args,
+    )
+
+    # --- Benchmark 4: Large data ---
+    run_benchmark(
+        f"Large data ({args.large_rows} rows, x + 1)",
+        udf_code="""
+@pandas_udf(LongType())
+def bench_udf(x: pd.Series) -> pd.Series:
+    return x + 1
+""",
+        make_df_code=f"spark.range({args.large_rows}, numPartitions={nparts})"
+        f'.select(col("id"), bench_udf(col("id")).alias("result"))',
+        args=args,
+    )
+
+    # --- Benchmark 5: Multiple UDF columns ---
+    run_benchmark(
+        "Multi-UDF (3 UDF columns)",
+        udf_code="""
+@pandas_udf(LongType())
+def udf_a(x: pd.Series) -> pd.Series:
+    return x + 1
+
+@pandas_udf(LongType())
+def udf_b(x: pd.Series) -> pd.Series:
+    return x * 2
+
+@pandas_udf(LongType())
+def udf_c(x: pd.Series) -> pd.Series:
+    return x - 1
+""",
+        make_df_code=f"spark.range({args.rows}, numPartitions={nparts})"
+        f'.select(col("id"), udf_a(col("id")).alias("a"), '
+        f'udf_b(col("id")).alias("b"), udf_c(col("id")).alias("c"))',
+        args=args,
+    )
+
+    print("=" * 78)
+    print("  Benchmark complete.")
+    print("=" * 78)
+
+
+if __name__ == "__main__":
+    main()
diff --git a/python/pyspark/sql/tests/pandas/test_pipelined_udf.py 
b/python/pyspark/sql/tests/pandas/test_pipelined_udf.py
new file mode 100644
index 000000000000..1e133f6e219b
--- /dev/null
+++ b/python/pyspark/sql/tests/pandas/test_pipelined_udf.py
@@ -0,0 +1,285 @@
+#
+# Licensed to the Apache Software Foundation (ASF) under one or more
+# contributor license agreements.  See the NOTICE file distributed with
+# this work for additional information regarding copyright ownership.
+# The ASF licenses this file to You under the Apache License, Version 2.0
+# (the "License"); you may not use this file except in compliance with
+# the License.  You may obtain a copy of the License at
+#
+#    http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+#
+
+"""
+Tests for pipelined Python UDF execution mode.
+
+These tests run with spark.python.udf.pipelined.enabled=true to verify
+correctness of the pipelined data transfer path for various UDF types.
+"""
+
+import os
+import unittest
+
+from pyspark import SparkConf
+from pyspark.sql.functions import col, pandas_udf, udf
+from pyspark.sql.types import (
+    DoubleType,
+    LongType,
+    StringType,
+    StructType,
+    StructField,
+)
+from pyspark.testing.sqlutils import ReusedSQLTestCase
+from pyspark.testing.utils import (
+    have_pandas,
+    have_pyarrow,
+    pandas_requirement_message,
+    pyarrow_requirement_message,
+)
+
+if have_pandas:
+    import pandas as pd
+
+
[email protected](
+    not have_pandas or not have_pyarrow,
+    pandas_requirement_message or pyarrow_requirement_message,
+)
+class PipelinedUDFTests(ReusedSQLTestCase):
+    """Tests that run with pipelined mode enabled."""
+
+    @classmethod
+    def conf(cls):
+        return (
+            SparkConf()
+            .set("spark.python.udf.pipelined.enabled", "true")
+            .set("spark.sql.execution.arrow.pyspark.enabled", "true")
+        )
+
+    def test_pipelined_mode_is_active(self):
+        """Verify the pipelined code path is actually being used."""
+
+        @pandas_udf(StringType())
+        def check_env(x: pd.Series) -> pd.Series:
+            # SPARK_PIPELINED_UDF is set by the JVM when pipelined mode is 
enabled.
+            flag = os.environ.get("SPARK_PIPELINED_UDF", "not_set")
+            return pd.Series([flag] * len(x))
+
+        result = self.spark.range(1).select(check_env(col("id"))).first()[0]
+        self.assertEqual(result, "1", "JVM should set SPARK_PIPELINED_UDF=1")
+
+    def test_scalar_arrow_udf(self):
+        """Basic scalar Arrow UDF with pipelined mode."""
+
+        @pandas_udf(LongType())
+        def add_one(x: pd.Series) -> pd.Series:
+            return x + 1
+
+        result = (
+            self.spark.range(100).select(col("id"), 
add_one(col("id")).alias("result")).collect()
+        )
+        for row in result:
+            self.assertEqual(row.result, row.id + 1)
+
+    def test_scalar_arrow_udf_string(self):
+        """Scalar Arrow UDF with string type."""
+
+        @pandas_udf(StringType())
+        def to_str(x: pd.Series) -> pd.Series:
+            return x.astype(str) + "_val"
+
+        result = self.spark.range(50).select(col("id"), 
to_str(col("id")).alias("s")).collect()
+        for row in result:
+            self.assertEqual(row.s, f"{row.id}_val")
+
+    def test_multiple_udf_columns(self):
+        """Multiple UDF columns in a single query."""
+
+        @pandas_udf(LongType())
+        def udf_a(x: pd.Series) -> pd.Series:
+            return x + 1
+
+        @pandas_udf(LongType())
+        def udf_b(x: pd.Series) -> pd.Series:
+            return x * 2
+
+        @pandas_udf(LongType())
+        def udf_c(x: pd.Series) -> pd.Series:
+            return x - 1
+
+        result = (
+            self.spark.range(100)
+            .select(
+                col("id"),
+                udf_a(col("id")).alias("a"),
+                udf_b(col("id")).alias("b"),
+                udf_c(col("id")).alias("c"),
+            )
+            .collect()
+        )
+        for row in result:
+            self.assertEqual(row.a, row.id + 1)
+            self.assertEqual(row.b, row.id * 2)
+            self.assertEqual(row.c, row.id - 1)
+
+    def test_multiple_partitions(self):
+        """UDF across multiple partitions."""
+
+        @pandas_udf(LongType())
+        def add_one(x: pd.Series) -> pd.Series:
+            return x + 1
+
+        result = (
+            self.spark.range(1000, numPartitions=4)
+            .select(col("id"), add_one(col("id")).alias("result"))
+            .collect()
+        )
+        self.assertEqual(len(result), 1000)
+        for row in result:
+            self.assertEqual(row.result, row.id + 1)
+
+    def test_empty_partition(self):
+        """UDF with some empty partitions."""
+
+        @pandas_udf(LongType())
+        def add_one(x: pd.Series) -> pd.Series:
+            return x + 1
+
+        # 2 rows across 4 partitions means some partitions are empty
+        result = (
+            self.spark.range(2, numPartitions=4)
+            .select(col("id"), add_one(col("id")).alias("result"))
+            .collect()
+        )
+        self.assertEqual(len(result), 2)
+        for row in result:
+            self.assertEqual(row.result, row.id + 1)
+
+    def test_chained_udf(self):
+        """Chained UDF calls."""
+
+        @pandas_udf(LongType())
+        def add_one(x: pd.Series) -> pd.Series:
+            return x + 1
+
+        @pandas_udf(LongType())
+        def double_it(x: pd.Series) -> pd.Series:
+            return x * 2
+
+        result = (
+            
self.spark.range(50).select(double_it(add_one(col("id"))).alias("result")).collect()
+        )
+        for row in result:
+            self.assertEqual(row.result, (row.result // 2) * 2)  # even number
+
+    def test_udf_with_null(self):
+        """UDF handling null values."""
+
+        @pandas_udf(LongType())
+        def add_one(x: pd.Series) -> pd.Series:
+            return x + 1
+
+        df = self.spark.createDataFrame(
+            [(1,), (None,), (3,), (None,), (5,)],
+            schema=StructType([StructField("v", LongType(), True)]),
+        )
+        result = df.select(col("v"), 
add_one(col("v")).alias("result")).collect()
+        expected = [(1, 2), (None, None), (3, 4), (None, None), (5, 6)]
+        for row, (v, r) in zip(result, expected):
+            self.assertEqual(row.v, v)
+            self.assertEqual(row.result, r)
+
+    def test_grouped_agg_udf(self):
+        """Grouped aggregation UDF (UDAF) with pipelined mode."""
+
+        @pandas_udf(DoubleType())
+        def mean_udf(x: pd.Series) -> float:
+            return float(x.mean())
+
+        df = self.spark.range(100).selectExpr("id", "id % 5 as grp")
+        result = 
df.groupBy("grp").agg(mean_udf(col("id")).alias("avg")).orderBy("grp").collect()
+
+        self.assertEqual(len(result), 5)
+        # grp=0: mean of 0,5,10,...,95 = 47.5
+        self.assertAlmostEqual(result[0].avg, 47.5)
+
+    def test_scalar_udf_large_data(self):
+        """Scalar UDF with large data to exercise backpressure."""
+
+        @pandas_udf(LongType())
+        def add_one(x: pd.Series) -> pd.Series:
+            return x + 1
+
+        result = (
+            self.spark.range(500000)
+            .select(add_one(col("id")).alias("result"))
+            .agg({"result": "sum"})
+            .collect()
+        )
+        # sum of (1..500000) = 500000 * 500001 / 2 = 125000250000
+        self.assertEqual(result[0][0], 125000250000)
+
+    def test_batched_udf(self):
+        """Non-Arrow batched UDF (pickle serialization)."""
+
+        @udf(StringType())
+        def simple_udf(x):
+            return str(x) + "_done"
+
+        result = self.spark.range(50).select(col("id"), 
simple_udf(col("id")).alias("s")).collect()
+        for row in result:
+            self.assertEqual(row.s, f"{row.id}_done")
+
+    def test_udf_exception_propagation(self):
+        """UDF that raises an exception should propagate correctly."""
+
+        @pandas_udf(LongType())
+        def bad_udf(x: pd.Series) -> pd.Series:
+            raise ValueError("intentional error")
+
+        with self.assertRaisesRegex(Exception, "intentional error"):
+            self.spark.range(10).select(bad_udf(col("id"))).collect()
+
+    def test_offheap_reader_with_head_does_not_segfault(self):
+        """Regression test: SPARK-33277 reproducer adapted for pipelined mode.
+
+        With the off-heap vectorized Parquet reader, head() triggers a
+        driver-side cancel of the still-running task. The task completion
+        listener for the writer thread must wait for the writer to actually
+        exit before subsequent listeners free off-heap memory backing the
+        rows the writer is still serializing. Otherwise the writer reads
+        invalidated off-heap memory and the executor segfaults.
+
+        The race is probabilistic (the SPARK-33277 PR reported ~3% failure
+        rate without the fix), so we repeat the head() many times to make
+        the test reliably crash without the fix while still finishing fast.
+        """
+        import shutil
+        import tempfile
+
+        path = tempfile.mkdtemp()
+        shutil.rmtree(path)
+        try:
+            self.spark.range(0, 200000, 1, 1).write.parquet(path)
+
+            @pandas_udf(LongType())
+            def to_zero(x: pd.Series) -> pd.Series:
+                return pd.Series([0] * len(x))
+
+            with self.sql_conf({"spark.sql.columnVector.offheap.enabled": 
"true"}):
+                for _ in range(100):
+                    row = 
self.spark.read.parquet(path).select(to_zero(col("id"))).head()
+                    self.assertEqual(row[0], 0)
+        finally:
+            shutil.rmtree(path, ignore_errors=True)
+
+
+if __name__ == "__main__":
+    from pyspark.testing import main
+
+    main()
diff --git a/python/pyspark/worker.py b/python/pyspark/worker.py
index 5a82d11ebe9b..5ceebca15338 100644
--- a/python/pyspark/worker.py
+++ b/python/pyspark/worker.py
@@ -26,6 +26,7 @@ import time
 import inspect
 import itertools
 import json
+import warnings
 from collections.abc import Iterator
 from typing import (
     Any,
@@ -3731,12 +3732,108 @@ def invoke_udf(message_receiver: SparkMessageReceiver, 
outfile: BinaryIO):
                 if hasattr(out_iter, "close"):
                     out_iter.close()
 
+        def pipelined_process():
+            """
+            Pipelined variant of process() that pre-fetches input batches in a 
background
+            reader thread while the main thread computes the UDF and writes 
output.
+            This allows input deserialization to overlap with UDF computation.
+            """
+            import queue
+            import threading
+
+            queue_depth = 
int(os.environ.get("SPARK_PIPELINED_UDF_QUEUE_DEPTH", "2"))
+            _SENTINEL = object()
+            input_queue = queue.Queue(maxsize=queue_depth)
+            reader_error = [None]
+            # Event to signal the reader thread to stop (set by main thread on
+            # exception or completion). The reader checks this after each 
failed
+            # put attempt instead of polling with a timeout.
+            stop_event = threading.Event()
+
+            def _reader_thread():
+                try:
+                    for batch in deserializer.load_stream(input_data_stream):
+                        # Some serializers (e.g., ArrowStreamGroupSerializer,
+                        # ArrowStreamAggPandasUDFSerializer) yield lazy 
iterators
+                        # that still read from the input stream. Materialize 
them here so
+                        # the main thread can consume them without touching 
the stream.
+                        if hasattr(batch, "__next__"):
+                            batch = list(batch)
+                        # Block on put, but wake up when stop_event is set.
+                        # stop_event.wait() returns immediately if already set.
+                        while not stop_event.is_set():
+                            try:
+                                input_queue.put(batch, timeout=0.1)
+                                break
+                            except queue.Full:
+                                continue
+                        if stop_event.is_set():
+                            return
+                except Exception as e:
+                    reader_error[0] = e
+                finally:
+                    # Enqueue sentinel so the consumer knows we're done.
+                    while not stop_event.is_set():
+                        try:
+                            input_queue.put(_SENTINEL, timeout=0.1)
+                            break
+                        except queue.Full:
+                            continue
+
+            t = threading.Thread(
+                target=_reader_thread, name="pyspark-pipelined-reader", 
daemon=True
+            )
+            t.start()
+
+            def _queued_iter():
+                while True:
+                    item = input_queue.get()
+                    if item is _SENTINEL:
+                        if reader_error[0] is not None:
+                            raise reader_error[0]
+                        return
+                    yield item
+
+            out_iter = func(init_info.split_index, _queued_iter())
+            try:
+                serializer.dump_stream(out_iter, outfile)
+            finally:
+                if hasattr(out_iter, "close"):
+                    out_iter.close()
+                # Signal reader thread to stop, drain the queue so it can 
unblock,
+                # then wait for it to finish.
+                stop_event.set()
+                try:
+                    while not input_queue.empty():
+                        input_queue.get_nowait()
+                except Exception:
+                    pass
+                # If the reader is still blocked in input_data_stream.read(), 
the stop_event
+                # check only fires between put attempts -- it cannot interrupt 
a syscall.
+                # Force-closing the stream here would break worker reuse (the 
next task uses
+                # the same socket fd), so we settle for a bounded join and a 
loud warning
+                # so an undetected leak shows up in the worker log.
+                t.join(timeout=5)
+                if t.is_alive():
+                    warnings.warn(
+                        "pipelined reader thread did not exit within 5s; "
+                        "it may still be blocked in input_data_stream.read() 
and could "
+                        "read data intended for a subsequent reused-worker 
task. "
+                        "Consider disabling spark.python.worker.reuse if this 
recurs.",
+                        RuntimeWarning,
+                    )
+
+        is_pipelined = os.environ.get("SPARK_PIPELINED_UDF") == "1"
+        if is_pipelined and hasattr(serializer, "_flush_per_batch"):
+            serializer._flush_per_batch = True
+        run_process = pipelined_process if is_pipelined else process
+
         processing_start_time = time.time()
         with capture_outputs():
             if profiler:
-                profiler.profile(process)
+                profiler.profile(run_process)
             else:
-                process()
+                run_process()
         processing_time_ms = int(1000 * (time.time() - processing_start_time))
 
         # Cleanup
diff --git 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ArrowAggregatePythonExec.scala
 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ArrowAggregatePythonExec.scala
index b265d1de54b6..09bfe6538420 100644
--- 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ArrowAggregatePythonExec.scala
+++ 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ArrowAggregatePythonExec.scala
@@ -23,6 +23,7 @@ import scala.collection.mutable.ArrayBuffer
 
 import org.apache.spark.{JobArtifactSet, SparkEnv, SparkException, TaskContext}
 import org.apache.spark.api.python.{ChainedPythonFunctions, PythonEvalType}
+import org.apache.spark.internal.config.Python.PYTHON_UDF_PIPELINED_EXECUTION
 import org.apache.spark.rdd.RDD
 import org.apache.spark.sql.catalyst.InternalRow
 import org.apache.spark.sql.catalyst.expressions._
@@ -176,8 +177,12 @@ case class ArrowAggregatePythonExec(
 
       // The queue used to buffer input rows so we can drain it to
       // combine input with output from Python.
+      // In pipelined mode the queue's add() runs in the writer thread and 
remove() runs in
+      // the task thread; use lock-free mode to skip per-row synchronization.
+      val pipelined = SparkEnv.get.conf.get(PYTHON_UDF_PIPELINED_EXECUTION)
       val queue = HybridRowQueue(context.taskMemoryManager(),
-        new File(Utils.getLocalDir(SparkEnv.get.conf)), 
groupingExpressions.length)
+        new File(Utils.getLocalDir(SparkEnv.get.conf)), 
groupingExpressions.length,
+        lockFree = pipelined)
       context.addTaskCompletionListener[Unit] { _ =>
         queue.close()
       }
diff --git 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ArrowWindowPythonEvaluatorFactory.scala
 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ArrowWindowPythonEvaluatorFactory.scala
index 5ba47db7fc94..ab9671c022f9 100644
--- 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ArrowWindowPythonEvaluatorFactory.scala
+++ 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ArrowWindowPythonEvaluatorFactory.scala
@@ -24,6 +24,7 @@ import scala.jdk.CollectionConverters._
 
 import org.apache.spark.{JobArtifactSet, PartitionEvaluator, 
PartitionEvaluatorFactory, SparkEnv, TaskContext}
 import org.apache.spark.api.python.ChainedPythonFunctions
+import org.apache.spark.internal.config.Python.PYTHON_UDF_PIPELINED_EXECUTION
 import org.apache.spark.sql.catalyst.InternalRow
 import org.apache.spark.sql.catalyst.expressions.{Attribute, 
AttributeReference, BoundReference, EmptyRow, Expression, JoinedRow, 
NamedArgumentExpression, NamedExpression, PythonFuncExpression, PythonUDAF, 
SortOrder, SpecificInternalRow, UnsafeProjection, UnsafeRow, WindowExpression}
 import org.apache.spark.sql.catalyst.expressions.aggregate.AggregateExpression
@@ -255,8 +256,11 @@ class ArrowWindowPythonEvaluatorFactory(
 
       // The queue used to buffer input rows so we can drain it to
       // combine input with output from Python.
+      // In pipelined mode the queue's add() runs in the writer thread and 
remove() runs in
+      // the task thread; use lock-free mode to skip per-row synchronization.
+      val pipelined = SparkEnv.get.conf.get(PYTHON_UDF_PIPELINED_EXECUTION)
       val queue = HybridRowQueue(context.taskMemoryManager(),
-        new File(Utils.getLocalDir(SparkEnv.get.conf)), childOutput.length)
+        new File(Utils.getLocalDir(SparkEnv.get.conf)), childOutput.length, 
lockFree = pipelined)
       context.addTaskCompletionListener[Unit] { _ =>
         queue.close()
       }
diff --git 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ColumnarArrowEvalPythonEvaluatorFactory.scala
 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ColumnarArrowEvalPythonEvaluatorFactory.scala
index 4e699f975fec..bad609919a4b 100644
--- 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ColumnarArrowEvalPythonEvaluatorFactory.scala
+++ 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/ColumnarArrowEvalPythonEvaluatorFactory.scala
@@ -24,6 +24,7 @@ import scala.jdk.CollectionConverters._
 
 import org.apache.spark.{PartitionEvaluator, PartitionEvaluatorFactory, 
SparkEnv, TaskContext}
 import org.apache.spark.api.python.ChainedPythonFunctions
+import org.apache.spark.internal.config.Python.PYTHON_UDF_PIPELINED_EXECUTION
 import org.apache.spark.sql.catalyst.InternalRow
 import org.apache.spark.sql.catalyst.expressions._
 import org.apache.spark.sql.errors.QueryExecutionErrors
@@ -235,10 +236,14 @@ private[python] class 
ColumnarArrowEvalPythonEvaluatorFactory(
         inputColumnIndices: Option[Array[Int]]
     ): Iterator[ColumnarBatch] = {
 
+      // In pipelined mode the queue's add() runs in the writer thread and 
remove() runs in
+      // the task thread; use lock-free mode to skip per-row synchronization.
+      val pipelined = SparkEnv.get.conf.get(PYTHON_UDF_PIPELINED_EXECUTION)
       val queue = HybridRowQueue(
         context.taskMemoryManager(),
         new File(Utils.getLocalDir(SparkEnv.get.conf)),
-        childOutput.length)
+        childOutput.length,
+        lockFree = pipelined)
       context.addTaskCompletionListener[Unit] { _ => queue.close() }
 
       val unsafeProj = UnsafeProjection.create(
diff --git 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/EvalPythonEvaluatorFactory.scala
 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/EvalPythonEvaluatorFactory.scala
index 34f9be0aa633..c0a983c60afa 100644
--- 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/EvalPythonEvaluatorFactory.scala
+++ 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/EvalPythonEvaluatorFactory.scala
@@ -23,6 +23,7 @@ import scala.collection.mutable.ArrayBuffer
 
 import org.apache.spark.{PartitionEvaluator, PartitionEvaluatorFactory, 
SparkEnv, TaskContext}
 import org.apache.spark.api.python.ChainedPythonFunctions
+import org.apache.spark.internal.config.Python.PYTHON_UDF_PIPELINED_EXECUTION
 import org.apache.spark.sql.catalyst.InternalRow
 import org.apache.spark.sql.catalyst.expressions._
 import org.apache.spark.sql.execution.python.EvalPythonExec.ArgumentMetadata
@@ -67,10 +68,15 @@ abstract class EvalPythonEvaluatorFactory(
 
       // The queue used to buffer input rows so we can drain it to
       // combine input with output from Python.
+      // In pipelined mode, add() runs in the writer thread and remove() in 
the task thread.
+      // Use lock-free mode to avoid synchronized overhead (memory visibility 
is guaranteed
+      // by the blocking socket I/O between the two threads).
+      val pipelined = SparkEnv.get.conf.get(PYTHON_UDF_PIPELINED_EXECUTION)
       val queue = HybridRowQueue(
         context.taskMemoryManager(),
         new File(Utils.getLocalDir(SparkEnv.get.conf)),
-        childOutput.length)
+        childOutput.length,
+        lockFree = pipelined)
       context.addTaskCompletionListener[Unit] { ctx =>
         queue.close()
       }
diff --git 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/EvalPythonUDTFExec.scala
 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/EvalPythonUDTFExec.scala
index 3cb9431fed6f..c5bad567add6 100644
--- 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/EvalPythonUDTFExec.scala
+++ 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/EvalPythonUDTFExec.scala
@@ -22,6 +22,7 @@ import java.io.File
 import scala.collection.mutable.ArrayBuffer
 
 import org.apache.spark.{SparkEnv, TaskContext}
+import org.apache.spark.internal.config.Python.PYTHON_UDF_PIPELINED_EXECUTION
 import org.apache.spark.rdd.RDD
 import org.apache.spark.sql.catalyst.InternalRow
 import org.apache.spark.sql.catalyst.expressions._
@@ -59,8 +60,11 @@ trait EvalPythonUDTFExec extends UnaryExecNode {
 
       // The queue used to buffer input rows so we can drain it to
       // combine input with output from Python.
+      // In pipelined mode the queue's add() runs in the writer thread and 
remove() runs in
+      // the task thread; use lock-free mode to skip per-row synchronization.
+      val pipelined = SparkEnv.get.conf.get(PYTHON_UDF_PIPELINED_EXECUTION)
       val queue = HybridRowQueue(context.taskMemoryManager(),
-        new File(Utils.getLocalDir(SparkEnv.get.conf)), child.output.length)
+        new File(Utils.getLocalDir(SparkEnv.get.conf)), child.output.length, 
lockFree = pipelined)
       context.addTaskCompletionListener[Unit] { ctx =>
         queue.close()
       }
diff --git 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/RowQueue.scala 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/RowQueue.scala
index d2008cfa1309..9f980be51d51 100644
--- 
a/sql/core/src/main/scala/org/apache/spark/sql/execution/python/RowQueue.scala
+++ 
b/sql/core/src/main/scala/org/apache/spark/sql/execution/python/RowQueue.scala
@@ -43,40 +43,63 @@ trait RowQueue extends Queue[UnsafeRow]
  * A RowQueue that is based on in-memory page. UnsafeRows are appended into it 
until it's full.
  * Another thread could read from it at the same time (behind the writer).
  *
+ * When `lockFree` is false (default), add() and remove() use synchronized for 
thread safety.
+ * When `lockFree` is true (pipelined Python UDF mode), synchronized is 
replaced by a
+ * volatile `writeOffset` using SPSC release-acquire semantics:
+ *  - add() performs a volatile store on writeOffset after writing row data 
(release fence),
+ *    ensuring all prior Platform.putInt/copyMemory writes are visible before 
the offset update.
+ *  - remove() performs a volatile load on writeOffset (acquire fence) to see 
the latest data.
+ *  - readOffset does not need to be volatile because the writer never reads 
it.
+ *
  * The format of UnsafeRow in page:
  * [4 bytes to hold length of record (N)] [N bytes to hold record] [...]
  *
  * -1 length means end of page.
  */
-private[python] abstract class InMemoryRowQueue(val page: MemoryBlock, 
numFields: Int)
+private[python] abstract class InMemoryRowQueue(
+    val page: MemoryBlock, numFields: Int, lockFree: Boolean = false)
   extends RowQueue {
   private val base: AnyRef = page.getBaseObject
   private val endOfPage: Long = page.getBaseOffset + page.size
   // the first location where a new row would be written
-  private var writeOffset = page.getBaseOffset
-  // points to the start of the next row to read
+  // When lockFree=true, this is accessed via volatile read/write for SPSC 
visibility.
+  // When lockFree=false, synchronized provides the memory barrier.
+  @volatile private var writeOffset = page.getBaseOffset
+  // points to the start of the next row to read (only updated by consumer)
   private var readOffset = page.getBaseOffset
   private val resultRow = new UnsafeRow(numFields)
 
-  def add(row: UnsafeRow): Boolean = synchronized {
+  private def doAdd(row: UnsafeRow): Boolean = {
+    // Cache writeOffset in a local var to avoid repeated volatile reads in 
lockFree mode.
+    val curOffset = writeOffset
     val size = row.getSizeInBytes
-    if (writeOffset + 4 + size > endOfPage) {
+    if (curOffset + 4 + size > endOfPage) {
       // if there is not enough space in this page to hold the new record
-      if (writeOffset + 4 <= endOfPage) {
+      if (curOffset + 4 <= endOfPage) {
         // if there's extra space at the end of the page, store a special 
"end-of-page" length (-1)
-        Platform.putInt(base, writeOffset, -1)
+        Platform.putInt(base, curOffset, -1)
+        // Volatile store to publish the end-of-page marker. The reader relies 
on seeing
+        // -1 to know this page is exhausted and switch to the next queue.
+        writeOffset = curOffset
       }
       false
     } else {
-      Platform.putInt(base, writeOffset, size)
-      Platform.copyMemory(row.getBaseObject, row.getBaseOffset, base, 
writeOffset + 4, size)
-      writeOffset += 4 + size
+      Platform.putInt(base, curOffset, size)
+      Platform.copyMemory(row.getBaseObject, row.getBaseOffset, base, 
curOffset + 4, size)
+      // Volatile store acts as a release fence: all prior writes (row data) 
are visible
+      // to any thread that subsequently reads this writeOffset via volatile 
load.
+      writeOffset = curOffset + 4 + size
       true
     }
   }
 
-  def remove(): UnsafeRow = synchronized {
-    assert(readOffset <= writeOffset, "reader should not go beyond writer")
+  private def doRemove(): UnsafeRow = {
+    // Volatile load acts as an acquire fence: ensures all row data written by 
the
+    // producer (before its volatile store of writeOffset) is visible to this 
thread.
+    // Read unconditionally into a local val so the acquire fence is not 
dependent on
+    // assert being enabled.
+    val curWriteOffset = writeOffset
+    assert(readOffset <= curWriteOffset, "reader should not go beyond writer")
     if (readOffset + 4 > endOfPage || Platform.getInt(base, readOffset) < 0) {
       null
     } else {
@@ -86,6 +109,12 @@ private[python] abstract class InMemoryRowQueue(val page: 
MemoryBlock, numFields
       resultRow
     }
   }
+
+  def add(row: UnsafeRow): Boolean =
+    if (lockFree) doAdd(row) else synchronized { doAdd(row) }
+
+  def remove(): UnsafeRow =
+    if (lockFree) doRemove() else synchronized { doRemove() }
 }
 
 /**
@@ -156,7 +185,8 @@ case class HybridRowQueue(
     memManager: TaskMemoryManager,
     tempDir: File,
     numFields: Int,
-    serMgr: SerializerManager)
+    serMgr: SerializerManager,
+    lockFree: Boolean = false)
   extends HybridQueue[UnsafeRow, RowQueue](memManager, tempDir, serMgr) {
 
   override protected def createDiskQueue(): RowQueue = {
@@ -164,7 +194,7 @@ case class HybridRowQueue(
   }
 
   override protected def createInMemoryQueue(page: MemoryBlock): RowQueue = {
-    new InMemoryRowQueue(page, numFields) {
+    new InMemoryRowQueue(page, numFields, lockFree) {
       override def close(): Unit = {
         freePage(this.page)
       }
@@ -185,6 +215,14 @@ object HybridRowQueue {
     HybridRowQueue(taskMemoryMgr, file, fields, SparkEnv.get.serializerManager)
   }
 
+  def apply(
+      taskMemoryMgr: TaskMemoryManager,
+      file: File,
+      fields: Int,
+      lockFree: Boolean): HybridRowQueue = {
+    HybridRowQueue(taskMemoryMgr, file, fields, 
SparkEnv.get.serializerManager, lockFree)
+  }
+
   def apply(taskMemoryMgr: TaskMemoryManager, fields: Int): HybridRowQueue = {
     apply(taskMemoryMgr, new File(Utils.getLocalDir(SparkEnv.get.conf)), 
fields)
   }


---------------------------------------------------------------------
To unsubscribe, e-mail: [email protected]
For additional commands, e-mail: [email protected]

Reply via email to