Hi all, Is there a way to draw multiple conformers of a single molecule using Draw.MolsToGridImage?
Here's a first attempt but, either all conformers are exactly the same or the parent molecule falls back to conformer 0, since all molecules in the grid appear the same: ``` from rdkit import Chem from rdkit.Chem import AllChem, Draw #indomethacin mol = Chem.MolFromSmiles('Cc1c(c2cc(ccc2n1C(=O)c3ccc(cc3)Cl)OC)CC(=O)O') mol = Chem.AddHs(mol) AllChem.EmbedMultipleConfs(mol, numConfs=10) mol = Chem.RemoveHs(mol) #drawBonds(mol) Draw.MolsToGridImage([mol.GetConformer(i).GetOwningMol() for i in range(10)]) ``` Perhaps a simpler question is, how do I access a single conformer from the 10 available in order to draw it? Thanks! Lewis
_______________________________________________ Rdkit-discuss mailing list Rdkit-discuss@lists.sourceforge.net https://lists.sourceforge.net/lists/listinfo/rdkit-discuss