Hi all, I initially wrote an fmoc smarts reaction to deprotect molecules as the following: reaction_smarts='[#7:1]C(=O)OCC1c2ccccc2-c3ccccc13>>[#7:1]'
Here's an example where this fails: from rdkit import Chem from rdkit.Chem import AllChem mol=Chem.MolFromSmiles('O=C(O)COC1(Cc2cc[nH]n2)CN(C(=O)OCC2c3ccccc3-c3ccccc32)C1') mol [image: image.png] reaction_smarts='[#7:1]C(=O)OCC1c2ccccc2-c3ccccc13>>[#7:1]' rxn = AllChem.ReactionFromSmarts(reaction_smarts) products = rxn.RunReactants((mol,)) products[0][0] [image: image.png] Now this gets solved by rewriting my smarts to '[#7;$([#7]C(=O)OCC1c2ccccc2-c3ccccc13):1]>>[#7:1]' but I don't understand what was wrong with the initial one and how it could create that result. This does not happen systematically to the building blocks I've been working with. Does anyone have an explanation for this or is it a bug? Thank you for your help! Fio
_______________________________________________ Rdkit-discuss mailing list Rdkit-discuss@lists.sourceforge.net https://lists.sourceforge.net/lists/listinfo/rdkit-discuss