On Tue, Aug 9, 2011 at 1:53 PM, JP <[email protected]> wrote: > I have been using sanifix3.py to get around the "Can't kekulize mol" > errors... I have a number of molecules which still give me this error > (~1000 mols) even after running the sanifix script. I am attaching a > sanifix3.py script which fails with two of these molecules as an example. I > can supply more if needed. > Can someone guide me on how I can fix this to get it to work? (or are all > these molecules chemically nonsense)
Oh, that was a fun one. The problem came because of the aromatic nitrogens attached to other ring atoms. These were not being properly handled in the fragmentation process. I've attached a corrected version, sanifix4.py -greg
""" This code belongs to James Davidson and is discussed here: http://www.mail-archive.com/[email protected]/msg01185.html http://www.mail-archive.com/[email protected]/msg01162.html http://www.mail-archive.com/[email protected]/msg01900.html """ mb = [ """MolPort-000-036-699 Marvin 05240819062D 39 44 0 0 0 0 999 V2000 -0.9093 -1.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1895 0.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4328 -1.6783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6446 -0.2242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9279 1.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6970 -1.2486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.9248 -2.3416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7064 -2.0738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.9991 0.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4698 1.7936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.1619 -0.0623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7811 0.2584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5409 0.8532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5876 0.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2762 1.6316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3768 -1.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1183 1.3358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1356 -0.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7100 -0.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4266 0.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5165 -0.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2362 0.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8523 1.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3505 0.6881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8243 2.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9452 -0.0342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6619 1.3639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8954 1.3078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6338 2.0925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2068 0.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8678 -0.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9155 -1.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6508 -2.6094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7019 1.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9266 2.1454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9635 0.3643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7250 -1.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4604 -2.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9991 -2.1361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 4 1 0 0 0 0 3 1 4 0 0 0 0 4 1 1 0 0 0 0 5 2 4 0 0 0 0 6 1 4 0 0 0 0 7 3 4 0 0 0 0 8 6 4 0 0 0 0 9 2 4 0 0 0 0 10 5 4 0 0 0 0 11 4 1 0 0 0 0 12 22 1 0 0 0 0 13 9 4 0 0 0 0 14 12 1 0 0 0 0 15 10 4 0 0 0 0 16 3 1 0 0 0 0 17 5 2 0 0 0 0 18 14 4 0 0 0 0 19 11 1 0 0 0 0 20 11 1 0 0 0 0 21 19 1 0 0 0 0 22 20 1 0 0 0 0 23 14 4 0 0 0 0 24 13 4 0 0 0 0 25 15 4 0 0 0 0 26 18 4 0 0 0 0 27 23 4 0 0 0 0 28 24 4 0 0 0 0 29 25 4 0 0 0 0 30 27 4 0 0 0 0 31 18 1 0 0 0 0 32 16 1 0 0 0 0 33 16 1 0 0 0 0 34 28 1 0 0 0 0 35 27 1 0 0 0 0 36 34 1 0 0 0 0 37 32 1 0 0 0 0 38 33 1 0 0 0 0 39 37 1 0 0 0 0 8 7 4 0 0 0 0 12 21 1 0 0 0 0 39 38 1 0 0 0 0 15 13 4 0 0 0 0 29 28 4 0 0 0 0 30 26 4 0 0 0 0 M END""", """MolPort-000-005-089 Marvin 05210810082D 19 21 0 0 0 0 999 V2000 1.4290 3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4290 2.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 2.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 2.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 3.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 3.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6425 2.3538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.1274 3.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6425 3.6888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.9525 3.0213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.8974 1.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3454 0.9562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6004 0.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4073 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.9594 0.6131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7044 1.3977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 3.8463 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 0.7145 4.6714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 3.4338 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 1 2 4 0 0 0 0 2 3 4 0 0 0 0 3 4 4 0 0 0 0 4 5 4 0 0 0 0 5 6 4 0 0 0 0 6 1 4 0 0 0 0 4 7 4 0 0 0 0 7 8 4 0 0 0 0 8 9 4 0 0 0 0 9 5 4 0 0 0 0 8 10 2 0 0 0 0 1 17 1 0 0 0 0 7 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 11 1 0 0 0 0 17 18 2 0 0 0 0 17 19 1 0 0 0 0 M CHG 2 17 1 19 -1 M STY 1 1 DAT M SAL 1 1 9 M SDT 1 MRV_IMPLICIT_H M SDD 1 0.0000 0.0000 DR ALL 0 0 M SED 1 IMPL_H1 M END > <PUBCHEM_EXT_DATASOURCE_REGID> MolPort-000-005-089 > <PUBCHEM_EXT_SUBSTANCE_URL> http://www.molport.com/buy-chemicals/molecule-link/MolPort-000-005-089 > <PUBCHEM_EXT_DATASOURCE_URL> http://www.molport.com $$$$""" ] from rdkit import Chem from rdkit.Chem import AllChem def FragIndicesToMol(oMol,indices): em = Chem.EditableMol(Chem.Mol()) newIndices={} for i,idx in enumerate(indices): em.AddAtom(oMol.GetAtomWithIdx(idx)) newIndices[idx]=i for i,idx in enumerate(indices): at = oMol.GetAtomWithIdx(idx) for bond in at.GetBonds(): if bond.GetBeginAtomIdx()==idx: oidx = bond.GetEndAtomIdx() else: oidx = bond.GetBeginAtomIdx() # make sure every bond only gets added once: if oidx<idx: continue em.AddBond(newIndices[idx],newIndices[oidx],bond.GetBondType()) res = em.GetMol() res.ClearComputedProps() Chem.GetSymmSSSR(res) res.UpdatePropertyCache(False) res._idxMap=newIndices return res def _recursivelyModifyNs(mol,matches,indices=None): if indices is None: indices=[] res=None while len(matches) and res is None: tIndices=indices[:] nextIdx = matches.pop(0) tIndices.append(nextIdx) nm = Chem.Mol(mol.ToBinary()) nm.GetAtomWithIdx(nextIdx).SetNoImplicit(True) nm.GetAtomWithIdx(nextIdx).SetNumExplicitHs(1) cp = Chem.Mol(nm.ToBinary()) try: Chem.SanitizeMol(cp) except ValueError: res,indices = _recursivelyModifyNs(nm,matches,indices=tIndices) else: indices=tIndices res=cp return res,indices def AdjustAromaticNs(m,nitrogenPattern='[n&D2&H0;r5,r6]'): """ default nitrogen pattern matches Ns in 5 rings and 6 rings in order to be able to fix: O=c1ccncc1 """ Chem.GetSymmSSSR(m) m.UpdatePropertyCache(False) # break non-ring bonds linking rings: em = Chem.EditableMol(m) linkers = m.GetSubstructMatches(Chem.MolFromSmarts('[r]!@[r]')) plsFix=set() for a,b in linkers: em.RemoveBond(a,b) plsFix.add(a) plsFix.add(b) nm = em.GetMol() for at in plsFix: at=nm.GetAtomWithIdx(at) if at.GetIsAromatic() and at.GetAtomicNum()==7: at.SetNumExplicitHs(1) at.SetNoImplicit(True) # build molecules from the fragments: fragLists = Chem.GetMolFrags(nm) frags = [FragIndicesToMol(nm,x) for x in fragLists] # loop through the fragments in turn and try to aromatize them: ok=True for i,frag in enumerate(frags): cp = Chem.Mol(frag.ToBinary()) try: Chem.SanitizeMol(cp) except ValueError: matches = [x[0] for x in frag.GetSubstructMatches(Chem.MolFromSmarts(nitrogenPattern))] lres,indices=_recursivelyModifyNs(frag,matches) if not lres: #print 'frag %d failed (%s)'%(i,str(fragLists[i])) ok=False break else: revMap={} for k,v in frag._idxMap.iteritems(): revMap[v]=k for idx in indices: oatom = m.GetAtomWithIdx(revMap[idx]) oatom.SetNoImplicit(True) oatom.SetNumExplicitHs(1) if not ok: return None return m if __name__=='__main__': ms= ( Chem.MolFromMolBlock(mb[0],False), Chem.MolFromSmiles('O=c1ccc2ccccc2n1',False), Chem.MolFromSmiles('Cc1nnnn1C',False), Chem.MolFromSmiles('CCc1ccc2nc(=O)c(cc2c1)Cc1nnnn1C1CCCCC1',False), Chem.MolFromMolBlock(mb[1],False), Chem.MolFromSmiles('c1cnc2cc3ccnc3cc12',False), Chem.MolFromSmiles('c1cc2cc3ccnc3cc2n1',False), Chem.MolFromSmiles('O=c1ccnc(c1)-c1cnc2cc3ccnc3cc12',False), Chem.MolFromSmiles('O=c1ccnc(c1)-c1cc1',False), ) for i,m in enumerate(ms): print '#---------------------' try: m.UpdatePropertyCache(False) cp = Chem.Mol(m.ToBinary()) Chem.SanitizeMol(cp) m = cp print 'fine:',Chem.MolToSmiles(m) except ValueError: nm=AdjustAromaticNs(m) if nm is not None: Chem.SanitizeMol(nm) print 'fixed:',Chem.MolToSmiles(nm) else: print 'still broken:',i
------------------------------------------------------------------------------ uberSVN's rich system and user administration capabilities and model configuration take the hassle out of deploying and managing Subversion and the tools developers use with it. Learn more about uberSVN and get a free download at: http://p.sf.net/sfu/wandisco-dev2dev
_______________________________________________ Rdkit-discuss mailing list [email protected] https://lists.sourceforge.net/lists/listinfo/rdkit-discuss

