Hi everyone, I'm having difficulties using RDKit to read molecules from an XYZ file, and I would really appreciate some help.
The problem is that whenever i read a molecule from an XYZ file, I get just a disconnected clump of atoms, not a molecule. For example: the following code: import rdkit from rdkit import Chem from rdkit.Chem import Draw, rdmolfiles mol = Chem.MolFromSmiles('COC1=C(O)C[C@@](O)(CO)CC1=O') mol = Chem.AddHs(mol) mol [image: image.png] Chem.AllChem.EmbedMolecule(mol) Chem.MolToXYZFile(mol, "rdkit_mol.xyz") mol2 = Chem.MolFromXYZFile('rdkit_mol.xyz') mol2 [image: image.png] Is there a bug on the XYZ code, or am I missing something? Thanks! -- Gustavo Seabra.
_______________________________________________ Rdkit-discuss mailing list Rdkit-discuss@lists.sourceforge.net https://lists.sourceforge.net/lists/listinfo/rdkit-discuss